About 3-(ethylsulfamoylamino)-1,1,1-trifluoropropan-2-ol
3-(ethylsulfamoylamino)-1,1,1-trifluoropropan-2-ol (PubChem CID 103833978) has the molecular formula C5H11F3N2O3S
and a molecular weight of 236.22 g/mol. Its IUPAC name is 3-(ethylsulfamoylamino)-1,1,1-trifluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-(ethylsulfamoylamino)-1,1,1-trifluoropropan-2-ol |
| PubChem CID | 103833978 |
| Molecular Formula | C5H11F3N2O3S |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3-(ethylsulfamoylamino)-1,1,1-trifluoropropan-2-ol |
| SMILES | CCNS(=O)(=O)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C5H11F3N2O3S/c1-2-9-14(12,13)10-3-4(11)5(6,7)8/h4,9-11H,2-3H2,1H3 |
| InChIKey | MBQYXPMIXBTQMV-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(ethylsulfamoylamino)-1,1,1-trifluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylsulfamoylamino)-1,1,1-trifluoropropan-2-ol?
The IUPAC name of 3-(ethylsulfamoylamino)-1,1,1-trifluoropropan-2-ol (CID 103833978) is 3-(ethylsulfamoylamino)-1,1,1-trifluoropropan-2-ol.
What is the SMILES notation for 3-(ethylsulfamoylamino)-1,1,1-trifluoropropan-2-ol?
The canonical SMILES for 3-(ethylsulfamoylamino)-1,1,1-trifluoropropan-2-ol is CCNS(=O)(=O)NCC(O)C(F)(F)F.
What is the InChIKey of 3-(ethylsulfamoylamino)-1,1,1-trifluoropropan-2-ol?
The InChIKey is MBQYXPMIXBTQMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11F3N2O3S/c1-2-9-14(12,13)10-3-4(11)5(6,7)8/h4,9-11H,2-3H2,1H3.
What are the key properties of 3-(ethylsulfamoylamino)-1,1,1-trifluoropropan-2-ol?
3-(ethylsulfamoylamino)-1,1,1-trifluoropropan-2-ol has a molecular weight of 236.22 g/mol, XLogP of -0.65, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylsulfamoylamino)-1,1,1-trifluoropropan-2-ol is sourced from PubChem (CID 103833978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).