C8H8ClF3N2O3S — CID 103834037
2-chloro-N-(3,3,3-trifluoro-2-hydroxypropyl)pyridine-3-sulfonamide (PubChem CID 103834037) has the molecular formula C8H8ClF3N2O3S and a molecular weight of 304.68 g/mol. Its IUPAC name is 2-chloro-N-(3,3,3-trifluoro-2-hydroxypropyl)pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-(3,3,3-trifluoro-2-hydroxypropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103834037 |
| Molecular Formula | C8H8ClF3N2O3S |
| Molecular Weight | 304.68 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 2-chloro-N-(3,3,3-trifluoro-2-hydroxypropyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCC(O)C(F)(F)F)c1cccnc1Cl |
| InChI | InChI=1S/C8H8ClF3N2O3S/c9-7-5(2-1-3-13-7)18(16,17)14-4-6(15)8(10,11)12/h1-3,6,14-15H,4H2 |
| InChIKey | ZGVJWOCZNCUFTM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.68 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|