About 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)ethanesulfonamide
2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)ethanesulfonamide (PubChem CID 103834045) has the molecular formula C6H12F3NO5S2
and a molecular weight of 299.29 g/mol. Its IUPAC name is 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)ethanesulfonamide.
Molecular Properties
| Compound Name | 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)ethanesulfonamide |
| PubChem CID | 103834045 |
| Molecular Formula | C6H12F3NO5S2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)ethanesulfonamide |
| SMILES | CS(=O)(=O)CCS(=O)(=O)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C6H12F3NO5S2/c1-16(12,13)2-3-17(14,15)10-4-5(11)6(7,8)9/h5,10-11H,2-4H2,1H3 |
| InChIKey | FVOFMAPEUHINRH-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)ethanesulfonamide?
The IUPAC name of 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)ethanesulfonamide (CID 103834045) is 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)ethanesulfonamide.
What is the SMILES notation for 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)ethanesulfonamide?
The canonical SMILES for 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)ethanesulfonamide is CS(=O)(=O)CCS(=O)(=O)NCC(O)C(F)(F)F.
What is the InChIKey of 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)ethanesulfonamide?
The InChIKey is FVOFMAPEUHINRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12F3NO5S2/c1-16(12,13)2-3-17(14,15)10-4-5(11)6(7,8)9/h5,10-11H,2-4H2,1H3.
What are the key properties of 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)ethanesulfonamide?
2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)ethanesulfonamide has a molecular weight of 299.29 g/mol, XLogP of -1.13, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfonyl-N-(3,3,3-trifluoro-2-hydroxypropyl)ethanesulfonamide is sourced from PubChem (CID 103834045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).