About methyl 5-bromo-4-[(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]thiophene-2-carboxylate
methyl 5-bromo-4-[(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]thiophene-2-carboxylate (PubChem CID 103834073) has the molecular formula C9H9BrF3NO5S2
and a molecular weight of 412.21 g/mol. Its IUPAC name is methyl 5-bromo-4-[(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-bromo-4-[(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]thiophene-2-carboxylate |
| PubChem CID | 103834073 |
| Molecular Formula | C9H9BrF3NO5S2 |
| Molecular Weight | 412.21 g/mol |
| Exact Mass | 410.91 |
| IUPAC Name | methyl 5-bromo-4-[(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NCC(O)C(F)(F)F)c(Br)s1 |
| InChI | InChI=1S/C9H9BrF3NO5S2/c1-19-8(16)4-2-5(7(10)20-4)21(17,18)14-3-6(15)9(11,12)13/h2,6,14-15H,3H2,1H3 |
| InChIKey | XMQRXHCJBAKOST-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-bromo-4-[(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-bromo-4-[(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]thiophene-2-carboxylate?
The IUPAC name of methyl 5-bromo-4-[(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]thiophene-2-carboxylate (CID 103834073) is methyl 5-bromo-4-[(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]thiophene-2-carboxylate.
What is the SMILES notation for methyl 5-bromo-4-[(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]thiophene-2-carboxylate?
The canonical SMILES for methyl 5-bromo-4-[(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]thiophene-2-carboxylate is COC(=O)c1cc(S(=O)(=O)NCC(O)C(F)(F)F)c(Br)s1.
What is the InChIKey of methyl 5-bromo-4-[(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]thiophene-2-carboxylate?
The InChIKey is XMQRXHCJBAKOST-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrF3NO5S2/c1-19-8(16)4-2-5(7(10)20-4)21(17,18)14-3-6(15)9(11,12)13/h2,6,14-15H,3H2,1H3.
What are the key properties of methyl 5-bromo-4-[(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]thiophene-2-carboxylate?
methyl 5-bromo-4-[(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]thiophene-2-carboxylate has a molecular weight of 412.21 g/mol, XLogP of 1.50, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-bromo-4-[(3,3,3-trifluoro-2-hydroxypropyl)sulfamoyl]thiophene-2-carboxylate is sourced from PubChem (CID 103834073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).