About 5-chloro-2-cyano-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide
5-chloro-2-cyano-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide (PubChem CID 103834086) has the molecular formula C10H8ClF3N2O3S
and a molecular weight of 328.70 g/mol. Its IUPAC name is 5-chloro-2-cyano-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 5-chloro-2-cyano-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide |
| PubChem CID | 103834086 |
| Molecular Formula | C10H8ClF3N2O3S |
| Molecular Weight | 328.70 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 5-chloro-2-cyano-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide |
| SMILES | N#Cc1ccc(Cl)cc1S(=O)(=O)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C10H8ClF3N2O3S/c11-7-2-1-6(4-15)8(3-7)20(18,19)16-5-9(17)10(12,13)14/h1-3,9,16-17H,5H2 |
| InChIKey | PDZBLHLBESKMPT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.70 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-2-cyano-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-cyano-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide?
The IUPAC name of 5-chloro-2-cyano-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide (CID 103834086) is 5-chloro-2-cyano-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide.
What is the SMILES notation for 5-chloro-2-cyano-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide?
The canonical SMILES for 5-chloro-2-cyano-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide is N#Cc1ccc(Cl)cc1S(=O)(=O)NCC(O)C(F)(F)F.
What is the InChIKey of 5-chloro-2-cyano-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide?
The InChIKey is PDZBLHLBESKMPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClF3N2O3S/c11-7-2-1-6(4-15)8(3-7)20(18,19)16-5-9(17)10(12,13)14/h1-3,9,16-17H,5H2.
What are the key properties of 5-chloro-2-cyano-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide?
5-chloro-2-cyano-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide has a molecular weight of 328.70 g/mol, XLogP of 1.41, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-cyano-N-(3,3,3-trifluoro-2-hydroxypropyl)benzenesulfonamide is sourced from PubChem (CID 103834086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).