C14H28O6P2 — CID 10383469
[(5E)-1-[hydroxy(hydroxymethyl)phosphoryl]-6,10-dimethylundeca-5,9-dienyl]phosphonic acid (PubChem CID 10383469) has the molecular formula C14H28O6P2 and a molecular weight of 354.32 g/mol. Its IUPAC name is [(5E)-1-[hydroxy(hydroxymethyl)phosphoryl]-6,10-dimethylundeca-5,9-dienyl]phosphonic acid.
| Compound Name | [(5E)-1-[hydroxy(hydroxymethyl)phosphoryl]-6,10-dimethylundeca-5,9-dienyl]phosphonic acid |
|---|---|
| PubChem CID | 10383469 |
| Molecular Formula | C14H28O6P2 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | [(5E)-1-[hydroxy(hydroxymethyl)phosphoryl]-6,10-dimethylundeca-5,9-dienyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CCCC(P(=O)(O)O)P(=O)(O)CO |
| InChI | InChI=1S/C14H28O6P2/c1-12(2)7-6-9-13(3)8-4-5-10-14(22(18,19)20)21(16,17)11-15/h7-8,14-15H,4-6,9-11H2,1-3H3,(H,16,17)(H2,18,19,20)/b13-8+ |
| InChIKey | MOUIHKXMHOTURX-MDWZMJQESA-N |
| XLogP | 3.57 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|