C9H16ClN3O3S2 — CID 103834891
5-chloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1-methylimidazole-4-sulfonamide (PubChem CID 103834891) has the molecular formula C9H16ClN3O3S2 and a molecular weight of 313.83 g/mol. Its IUPAC name is 5-chloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1-methylimidazole-4-sulfonamide.
| Compound Name | 5-chloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 103834891 |
| Molecular Formula | C9H16ClN3O3S2 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 5-chloro-N-[2-(3-hydroxypropylsulfanyl)ethyl]-1-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)NCCSCCCO)c1Cl |
| InChI | InChI=1S/C9H16ClN3O3S2/c1-13-7-11-9(8(13)10)18(15,16)12-3-6-17-5-2-4-14/h7,12,14H,2-6H2,1H3 |
| InChIKey | FXZDSEIMLUZDMD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|