C12H23N3O3S — CID 103835178
N-(3-ethyl-2-hydroxypentyl)-1,2-dimethylimidazole-4-sulfonamide (PubChem CID 103835178) has the molecular formula C12H23N3O3S and a molecular weight of 289.40 g/mol. Its IUPAC name is N-(3-ethyl-2-hydroxypentyl)-1,2-dimethylimidazole-4-sulfonamide.
| Compound Name | N-(3-ethyl-2-hydroxypentyl)-1,2-dimethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 103835178 |
| Molecular Formula | C12H23N3O3S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-(3-ethyl-2-hydroxypentyl)-1,2-dimethylimidazole-4-sulfonamide |
| SMILES | CCC(CC)C(O)CNS(=O)(=O)c1cn(C)c(C)n1 |
| InChI | InChI=1S/C12H23N3O3S/c1-5-10(6-2)11(16)7-13-19(17,18)12-8-15(4)9(3)14-12/h8,10-11,13,16H,5-7H2,1-4H3 |
| InChIKey | NICCWBNDFQSIEV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |