C16H25N3O2S2 — CID 10383582
trans-(1S,2R)-2-[2-(methanesulfonamido)ethyl]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide (PubChem CID 10383582) has the molecular formula C16H25N3O2S2 and a molecular weight of 355.53 g/mol. Its IUPAC name is trans-(1S,2R)-2-[2-(methanesulfonamido)ethyl]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide.
| Compound Name | trans-(1S,2R)-2-[2-(methanesulfonamido)ethyl]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 10383582 |
| Molecular Formula | C16H25N3O2S2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | trans-(1S,2R)-2-[2-(methanesulfonamido)ethyl]-N-methyl-1-pyridin-3-ylcyclohexane-1-carbothioamide |
| SMILES | CNC(=S)[C@@]1(c2cccnc2)CCCC[C@@H]1CCNS(C)(=O)=O |
| InChI | InChI=1S/C16H25N3O2S2/c1-17-15(22)16(14-7-5-10-18-12-14)9-4-3-6-13(16)8-11-19-23(2,20)21/h5,7,10,12-13,19H,3-4,6,8-9,11H2,1-2H3,(H,17,22)/t13-,16+/m1/s1 |
| InChIKey | NCZOSJNXRWZKOO-CJNGLKHVSA-N |
| XLogP | 2.00 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|