C15H23NO4S — CID 103836509
N-(4-hydroxy-2,2-dimethylbutyl)-3-propanoylbenzenesulfonamide (PubChem CID 103836509) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylbutyl)-3-propanoylbenzenesulfonamide.
| Compound Name | N-(4-hydroxy-2,2-dimethylbutyl)-3-propanoylbenzenesulfonamide |
|---|---|
| PubChem CID | 103836509 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylbutyl)-3-propanoylbenzenesulfonamide |
| SMILES | CCC(=O)c1cccc(S(=O)(=O)NCC(C)(C)CCO)c1 |
| InChI | InChI=1S/C15H23NO4S/c1-4-14(18)12-6-5-7-13(10-12)21(19,20)16-11-15(2,3)8-9-17/h5-7,10,16-17H,4,8-9,11H2,1-3H3 |
| InChIKey | WLVOEWDIRKURIQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |