C9H18F2N2O3S — CID 103836832
N-(3,3-difluoro-2-hydroxypropyl)azepane-1-sulfonamide (PubChem CID 103836832) has the molecular formula C9H18F2N2O3S and a molecular weight of 272.32 g/mol. Its IUPAC name is N-(3,3-difluoro-2-hydroxypropyl)azepane-1-sulfonamide.
| Compound Name | N-(3,3-difluoro-2-hydroxypropyl)azepane-1-sulfonamide |
|---|---|
| PubChem CID | 103836832 |
| Molecular Formula | C9H18F2N2O3S |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | N-(3,3-difluoro-2-hydroxypropyl)azepane-1-sulfonamide |
| SMILES | O=S(=O)(NCC(O)C(F)F)N1CCCCCC1 |
| InChI | InChI=1S/C9H18F2N2O3S/c10-9(11)8(14)7-12-17(15,16)13-5-3-1-2-4-6-13/h8-9,12,14H,1-7H2 |
| InChIKey | PTHZRIFDRAOPFK-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |