C8H9ClF2N2O3S — CID 103836835
2-chloro-N-(3,3-difluoro-2-hydroxypropyl)pyridine-3-sulfonamide (PubChem CID 103836835) has the molecular formula C8H9ClF2N2O3S and a molecular weight of 286.69 g/mol. Its IUPAC name is 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103836835 |
| Molecular Formula | C8H9ClF2N2O3S |
| Molecular Weight | 286.69 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCC(O)C(F)F)c1cccnc1Cl |
| InChI | InChI=1S/C8H9ClF2N2O3S/c9-7-6(2-1-3-12-7)17(15,16)13-4-5(14)8(10)11/h1-3,5,8,13-14H,4H2 |
| InChIKey | DRRXJYFVXOSVOA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.69 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|