About 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-methyl-1,3-thiazole-5-sulfonamide
2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 103836874) has the molecular formula C7H9ClF2N2O3S2
and a molecular weight of 306.74 g/mol. Its IUPAC name is 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-methyl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-methyl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 103836874 |
| Molecular Formula | C7H9ClF2N2O3S2 |
| Molecular Weight | 306.74 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(Cl)sc1S(=O)(=O)NCC(O)C(F)F |
| InChI | InChI=1S/C7H9ClF2N2O3S2/c1-3-6(16-7(8)12-3)17(14,15)11-2-4(13)5(9)10/h4-5,11,13H,2H2,1H3 |
| InChIKey | NTZROWJOAMBTKB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.74 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-methyl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-methyl-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-methyl-1,3-thiazole-5-sulfonamide (CID 103836874) is 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-methyl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-methyl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-methyl-1,3-thiazole-5-sulfonamide is Cc1nc(Cl)sc1S(=O)(=O)NCC(O)C(F)F.
What is the InChIKey of 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-methyl-1,3-thiazole-5-sulfonamide?
The InChIKey is NTZROWJOAMBTKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClF2N2O3S2/c1-3-6(16-7(8)12-3)17(14,15)11-2-4(13)5(9)10/h4-5,11,13H,2H2,1H3.
What are the key properties of 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-methyl-1,3-thiazole-5-sulfonamide?
2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-methyl-1,3-thiazole-5-sulfonamide has a molecular weight of 306.74 g/mol, XLogP of 1.01, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-methyl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 103836874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).