About 3-(3,3-difluoro-2-hydroxypropyl)-1,1-diethylurea
3-(3,3-difluoro-2-hydroxypropyl)-1,1-diethylurea (PubChem CID 103836921) has the molecular formula C8H16F2N2O2
and a molecular weight of 210.22 g/mol. Its IUPAC name is 3-(3,3-difluoro-2-hydroxypropyl)-1,1-diethylurea.
Molecular Properties
| Compound Name | 3-(3,3-difluoro-2-hydroxypropyl)-1,1-diethylurea |
| PubChem CID | 103836921 |
| Molecular Formula | C8H16F2N2O2 |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 3-(3,3-difluoro-2-hydroxypropyl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCC(O)C(F)F |
| InChI | InChI=1S/C8H16F2N2O2/c1-3-12(4-2)8(14)11-5-6(13)7(9)10/h6-7,13H,3-5H2,1-2H3,(H,11,14) |
| InChIKey | UEIAIXPYMWDFNG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,3-difluoro-2-hydroxypropyl)-1,1-diethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-difluoro-2-hydroxypropyl)-1,1-diethylurea?
The IUPAC name of 3-(3,3-difluoro-2-hydroxypropyl)-1,1-diethylurea (CID 103836921) is 3-(3,3-difluoro-2-hydroxypropyl)-1,1-diethylurea.
What is the SMILES notation for 3-(3,3-difluoro-2-hydroxypropyl)-1,1-diethylurea?
The canonical SMILES for 3-(3,3-difluoro-2-hydroxypropyl)-1,1-diethylurea is CCN(CC)C(=O)NCC(O)C(F)F.
What is the InChIKey of 3-(3,3-difluoro-2-hydroxypropyl)-1,1-diethylurea?
The InChIKey is UEIAIXPYMWDFNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F2N2O2/c1-3-12(4-2)8(14)11-5-6(13)7(9)10/h6-7,13H,3-5H2,1-2H3,(H,11,14).
What are the key properties of 3-(3,3-difluoro-2-hydroxypropyl)-1,1-diethylurea?
3-(3,3-difluoro-2-hydroxypropyl)-1,1-diethylurea has a molecular weight of 210.22 g/mol, XLogP of 0.66, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-difluoro-2-hydroxypropyl)-1,1-diethylurea is sourced from PubChem (CID 103836921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).