C13H18F3NO3 — CID 103837153
(1S,6R)-6-(5,5,5-trifluoropentylcarbamoyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 103837153) has the molecular formula C13H18F3NO3 and a molecular weight of 293.29 g/mol. Its IUPAC name is (1S,6R)-6-(5,5,5-trifluoropentylcarbamoyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-(5,5,5-trifluoropentylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 103837153 |
| Molecular Formula | C13H18F3NO3 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | (1S,6R)-6-(5,5,5-trifluoropentylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@H]1C(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C13H18F3NO3/c14-13(15,16)7-3-4-8-17-11(18)9-5-1-2-6-10(9)12(19)20/h1-2,9-10H,3-8H2,(H,17,18)(H,19,20)/t9-,10+/m1/s1 |
| InChIKey | SDCVXEFNLGQJOC-ZJUUUORDSA-N |
| XLogP | 2.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|