About N-cyclopropyl-2,2-dimethylcyclopropane-1-carboxamide
N-cyclopropyl-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 103837193) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is N-cyclopropyl-2,2-dimethylcyclopropane-1-carboxamide.
Analyze N-cyclopropyl-2,2-dimethylcyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2,2-dimethylcyclopropane-1-carboxamide?
The IUPAC name of N-cyclopropyl-2,2-dimethylcyclopropane-1-carboxamide (CID 103837193) is N-cyclopropyl-2,2-dimethylcyclopropane-1-carboxamide.
What is the SMILES notation for N-cyclopropyl-2,2-dimethylcyclopropane-1-carboxamide?
The canonical SMILES for N-cyclopropyl-2,2-dimethylcyclopropane-1-carboxamide is CC1(C)CC1C(=O)NC1CC1.
What is the InChIKey of N-cyclopropyl-2,2-dimethylcyclopropane-1-carboxamide?
The InChIKey is IOWVFQMRIJQZNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-9(2)5-7(9)8(11)10-6-3-4-6/h6-7H,3-5H2,1-2H3,(H,10,11).
What are the key properties of N-cyclopropyl-2,2-dimethylcyclopropane-1-carboxamide?
N-cyclopropyl-2,2-dimethylcyclopropane-1-carboxamide has a molecular weight of 153.22 g/mol, XLogP of 1.31, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2,2-dimethylcyclopropane-1-carboxamide is sourced from PubChem (CID 103837193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).