C20H20F2N2S — CID 10383777
(11S,16R)-3-(2,6-difluorophenyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene (PubChem CID 10383777) has the molecular formula C20H20F2N2S and a molecular weight of 358.46 g/mol. Its IUPAC name is (11S,16R)-3-(2,6-difluorophenyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene.
| Compound Name | (11S,16R)-3-(2,6-difluorophenyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
|---|---|
| PubChem CID | 10383777 |
| Molecular Formula | C20H20F2N2S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (11S,16R)-3-(2,6-difluorophenyl)-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
| SMILES | Fc1cccc(F)c1-c1cc2c3c(c1)[C@@H]1CNCC[C@@H]1N3CCCS2 |
| InChI | InChI=1S/C20H20F2N2S/c21-15-3-1-4-16(22)19(15)12-9-13-14-11-23-6-5-17(14)24-7-2-8-25-18(10-12)20(13)24/h1,3-4,9-10,14,17,23H,2,5-8,11H2/t14-,17-/m0/s1 |
| InChIKey | IHZJIGQJOSYARO-YOEHRIQHSA-N |
| XLogP | 4.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |