C16H14FN5O4 — CID 10383817
[(2S,4S)-4-(6-amino-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate (PubChem CID 10383817) has the molecular formula C16H14FN5O4 and a molecular weight of 359.32 g/mol. Its IUPAC name is [(2S,4S)-4-(6-amino-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,4S)-4-(6-amino-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 10383817 |
| Molecular Formula | C16H14FN5O4 |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | [(2S,4S)-4-(6-amino-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate |
| SMILES | Nc1nc(F)nc2c1ncn2[C@@H]1CO[C@H](COC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C16H14FN5O4/c17-16-20-13(18)12-14(21-16)22(8-19-12)10-6-24-11(26-10)7-25-15(23)9-4-2-1-3-5-9/h1-5,8,10-11H,6-7H2,(H2,18,20,21)/t10-,11-/m0/s1 |
| InChIKey | SFVZCZAZYIXFST-QWRGUYRKSA-N |
| XLogP | 1.28 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |