About 1-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(oxolan-3-yl)urea
1-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(oxolan-3-yl)urea (PubChem CID 103839130) has the molecular formula C11H18N4O2S
and a molecular weight of 270.36 g/mol. Its IUPAC name is 1-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(oxolan-3-yl)urea.
Molecular Properties
| Compound Name | 1-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(oxolan-3-yl)urea |
| PubChem CID | 103839130 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(oxolan-3-yl)urea |
| SMILES | CC(C)Cc1nnc(NC(=O)NC2CCOC2)s1 |
| InChI | InChI=1S/C11H18N4O2S/c1-7(2)5-9-14-15-11(18-9)13-10(16)12-8-3-4-17-6-8/h7-8H,3-6H2,1-2H3,(H2,12,13,15,16) |
| InChIKey | LBIFVGMUGOZBTK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(oxolan-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(oxolan-3-yl)urea?
The IUPAC name of 1-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(oxolan-3-yl)urea (CID 103839130) is 1-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(oxolan-3-yl)urea.
What is the SMILES notation for 1-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(oxolan-3-yl)urea?
The canonical SMILES for 1-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(oxolan-3-yl)urea is CC(C)Cc1nnc(NC(=O)NC2CCOC2)s1.
What is the InChIKey of 1-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(oxolan-3-yl)urea?
The InChIKey is LBIFVGMUGOZBTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O2S/c1-7(2)5-9-14-15-11(18-9)13-10(16)12-8-3-4-17-6-8/h7-8H,3-6H2,1-2H3,(H2,12,13,15,16).
What are the key properties of 1-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(oxolan-3-yl)urea?
1-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(oxolan-3-yl)urea has a molecular weight of 270.36 g/mol, XLogP of 1.65, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-3-(oxolan-3-yl)urea is sourced from PubChem (CID 103839130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).