About 1-benzyl-3-[5-(methoxymethyl)furan-2-yl]-[1,3]dioxolo[4,5-f]indazole
1-benzyl-3-[5-(methoxymethyl)furan-2-yl]-[1,3]dioxolo[4,5-f]indazole (PubChem CID 10384020) has the molecular formula C21H18N2O4
and a molecular weight of 362.39 g/mol. Its IUPAC name is 1-benzyl-3-[5-(methoxymethyl)furan-2-yl]-[1,3]dioxolo[4,5-f]indazole.
Molecular Properties
| Compound Name | 1-benzyl-3-[5-(methoxymethyl)furan-2-yl]-[1,3]dioxolo[4,5-f]indazole |
| PubChem CID | 10384020 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 1-benzyl-3-[5-(methoxymethyl)furan-2-yl]-[1,3]dioxolo[4,5-f]indazole |
| SMILES | COCc1ccc(-c2nn(Cc3ccccc3)c3cc4c(cc23)OCO4)o1 |
| InChI | InChI=1S/C21H18N2O4/c1-24-12-15-7-8-18(27-15)21-16-9-19-20(26-13-25-19)10-17(16)23(22-21)11-14-5-3-2-4-6-14/h2-10H,11-13H2,1H3 |
| InChIKey | WVKNFUWQPIKZDA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 58.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-benzyl-3-[5-(methoxymethyl)furan-2-yl]-[1,3]dioxolo[4,5-f]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-[5-(methoxymethyl)furan-2-yl]-[1,3]dioxolo[4,5-f]indazole?
The IUPAC name of 1-benzyl-3-[5-(methoxymethyl)furan-2-yl]-[1,3]dioxolo[4,5-f]indazole (CID 10384020) is 1-benzyl-3-[5-(methoxymethyl)furan-2-yl]-[1,3]dioxolo[4,5-f]indazole.
What is the SMILES notation for 1-benzyl-3-[5-(methoxymethyl)furan-2-yl]-[1,3]dioxolo[4,5-f]indazole?
The canonical SMILES for 1-benzyl-3-[5-(methoxymethyl)furan-2-yl]-[1,3]dioxolo[4,5-f]indazole is COCc1ccc(-c2nn(Cc3ccccc3)c3cc4c(cc23)OCO4)o1.
What is the InChIKey of 1-benzyl-3-[5-(methoxymethyl)furan-2-yl]-[1,3]dioxolo[4,5-f]indazole?
The InChIKey is WVKNFUWQPIKZDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O4/c1-24-12-15-7-8-18(27-15)21-16-9-19-20(26-13-25-19)10-17(16)23(22-21)11-14-5-3-2-4-6-14/h2-10H,11-13H2,1H3.
What are the key properties of 1-benzyl-3-[5-(methoxymethyl)furan-2-yl]-[1,3]dioxolo[4,5-f]indazole?
1-benzyl-3-[5-(methoxymethyl)furan-2-yl]-[1,3]dioxolo[4,5-f]indazole has a molecular weight of 362.39 g/mol, XLogP of 4.22, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-[5-(methoxymethyl)furan-2-yl]-[1,3]dioxolo[4,5-f]indazole is sourced from PubChem (CID 10384020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).