C11H13N3O2 — CID 103840464
(6,7-dimethoxyisoquinolin-1-yl)hydrazine (PubChem CID 103840464) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is (6,7-dimethoxyisoquinolin-1-yl)hydrazine.
| Compound Name | (6,7-dimethoxyisoquinolin-1-yl)hydrazine |
|---|---|
| PubChem CID | 103840464 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | (6,7-dimethoxyisoquinolin-1-yl)hydrazine |
| SMILES | COc1cc2ccnc(NN)c2cc1OC |
| InChI | InChI=1S/C11H13N3O2/c1-15-9-5-7-3-4-13-11(14-12)8(7)6-10(9)16-2/h3-6H,12H2,1-2H3,(H,13,14) |
| InChIKey | WNYKHAFFVWVQJF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|