C8H13N3 — CID 103840674
1-cyclobutyl-4-methylimidazol-2-amine (PubChem CID 103840674) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-cyclobutyl-4-methylimidazol-2-amine.
| Compound Name | 1-cyclobutyl-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 103840674 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 1-cyclobutyl-4-methylimidazol-2-amine |
| SMILES | Cc1cn(C2CCC2)c(N)n1 |
| InChI | InChI=1S/C8H13N3/c1-6-5-11(8(9)10-6)7-3-2-4-7/h5,7H,2-4H2,1H3,(H2,9,10) |
| InChIKey | ZXQKWFMHPLLQTD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |