C7H12F2N2O2 — CID 103840827
1-[2-(aminomethyl)morpholin-4-yl]-2,2-difluoroethanone (PubChem CID 103840827) has the molecular formula C7H12F2N2O2 and a molecular weight of 194.18 g/mol. Its IUPAC name is 1-[2-(aminomethyl)morpholin-4-yl]-2,2-difluoroethanone.
| Compound Name | 1-[2-(aminomethyl)morpholin-4-yl]-2,2-difluoroethanone |
|---|---|
| PubChem CID | 103840827 |
| Molecular Formula | C7H12F2N2O2 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-[2-(aminomethyl)morpholin-4-yl]-2,2-difluoroethanone |
| SMILES | NCC1CN(C(=O)C(F)F)CCO1 |
| InChI | InChI=1S/C7H12F2N2O2/c8-6(9)7(12)11-1-2-13-5(3-10)4-11/h5-6H,1-4,10H2 |
| InChIKey | FUPRJTKWXAGMEX-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |