C17H19BrN2S — CID 10384083
(6aR,10aR)-2-bromo-7,9-dimethyl-5-methylsulfanyl-6,6a,8,10a-tetrahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 10384083) has the molecular formula C17H19BrN2S and a molecular weight of 363.32 g/mol. Its IUPAC name is (6aR,10aR)-2-bromo-7,9-dimethyl-5-methylsulfanyl-6,6a,8,10a-tetrahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | (6aR,10aR)-2-bromo-7,9-dimethyl-5-methylsulfanyl-6,6a,8,10a-tetrahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 10384083 |
| Molecular Formula | C17H19BrN2S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | (6aR,10aR)-2-bromo-7,9-dimethyl-5-methylsulfanyl-6,6a,8,10a-tetrahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | CSc1[nH]c2cc(Br)cc3c2c1C[C@@H]1[C@@H]3C=C(C)CN1C |
| InChI | InChI=1S/C17H19BrN2S/c1-9-4-11-12-5-10(18)6-14-16(12)13(17(19-14)21-3)7-15(11)20(2)8-9/h4-6,11,15,19H,7-8H2,1-3H3/t11-,15-/m1/s1 |
| InChIKey | VVZLHSZLGOZMJI-IAQYHMDHSA-N |
| XLogP | 4.55 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|