C15H27F3N2O2 — CID 103841349
tert-butyl N-[[2-(4,4,4-trifluorobutylamino)cyclopentyl]methyl]carbamate (PubChem CID 103841349) has the molecular formula C15H27F3N2O2 and a molecular weight of 324.39 g/mol. Its IUPAC name is tert-butyl N-[[2-(4,4,4-trifluorobutylamino)cyclopentyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-(4,4,4-trifluorobutylamino)cyclopentyl]methyl]carbamate |
|---|---|
| PubChem CID | 103841349 |
| Molecular Formula | C15H27F3N2O2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | tert-butyl N-[[2-(4,4,4-trifluorobutylamino)cyclopentyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCC1NCCCC(F)(F)F |
| InChI | InChI=1S/C15H27F3N2O2/c1-14(2,3)22-13(21)20-10-11-6-4-7-12(11)19-9-5-8-15(16,17)18/h11-12,19H,4-10H2,1-3H3,(H,20,21) |
| InChIKey | OSFBAAAMOKQFJB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|