C16H21FN6O3 — CID 10384150
N-[(2R)-2-[[(7-fluoro-1,2,4-benzotriazin-3-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide (PubChem CID 10384150) has the molecular formula C16H21FN6O3 and a molecular weight of 364.38 g/mol. Its IUPAC name is N-[(2R)-2-[[(7-fluoro-1,2,4-benzotriazin-3-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide.
| Compound Name | N-[(2R)-2-[[(7-fluoro-1,2,4-benzotriazin-3-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 10384150 |
| Molecular Formula | C16H21FN6O3 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | N-[(2R)-2-[[(7-fluoro-1,2,4-benzotriazin-3-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NNc1nnc2cc(F)ccc2n1 |
| InChI | InChI=1S/C16H21FN6O3/c1-2-3-4-5-11(9-23(26)10-24)15(25)20-22-16-18-13-7-6-12(17)8-14(13)19-21-16/h6-8,10-11,26H,2-5,9H2,1H3,(H,20,25)(H,18,21,22)/t11-/m1/s1 |
| InChIKey | PEJSHZCFMRUBLR-LLVKDONJSA-N |
| XLogP | 1.65 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|