C18H26ClN3O3 — CID 10384371
4-chloro-1-[(1R)-1-[(4R)-2-ethoxy-1,3-dioxolan-4-yl]heptyl]imidazo[4,5-c]pyridine (PubChem CID 10384371) has the molecular formula C18H26ClN3O3 and a molecular weight of 367.88 g/mol. Its IUPAC name is 4-chloro-1-[(1R)-1-[(4R)-2-ethoxy-1,3-dioxolan-4-yl]heptyl]imidazo[4,5-c]pyridine.
| Compound Name | 4-chloro-1-[(1R)-1-[(4R)-2-ethoxy-1,3-dioxolan-4-yl]heptyl]imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 10384371 |
| Molecular Formula | C18H26ClN3O3 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 4-chloro-1-[(1R)-1-[(4R)-2-ethoxy-1,3-dioxolan-4-yl]heptyl]imidazo[4,5-c]pyridine |
| SMILES | CCCCCC[C@H]([C@@H]1COC(OCC)O1)n1cnc2c(Cl)nccc21 |
| InChI | InChI=1S/C18H26ClN3O3/c1-3-5-6-7-8-13(15-11-24-18(25-15)23-4-2)22-12-21-16-14(22)9-10-20-17(16)19/h9-10,12-13,15,18H,3-8,11H2,1-2H3/t13-,15+,18?/m1/s1 |
| InChIKey | JZBXBUJVBFMSRD-PWXCZCIESA-N |
| XLogP | 4.33 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|