C16H22N2O — CID 103845316
N-[2-[[2-(cyclopenten-1-yl)ethylamino]methyl]phenyl]acetamide (PubChem CID 103845316) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is N-[2-[[2-(cyclopenten-1-yl)ethylamino]methyl]phenyl]acetamide.
| Compound Name | N-[2-[[2-(cyclopenten-1-yl)ethylamino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 103845316 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-[2-[[2-(cyclopenten-1-yl)ethylamino]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1CNCCC1=CCCC1 |
| InChI | InChI=1S/C16H22N2O/c1-13(19)18-16-9-5-4-8-15(16)12-17-11-10-14-6-2-3-7-14/h4-6,8-9,17H,2-3,7,10-12H2,1H3,(H,18,19) |
| InChIKey | FJUKLQUZQYXHQC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|