C16H25NO4 — CID 103845860
tert-butyl 2-(2,6-dioxocyclohexyl)piperidine-1-carboxylate (PubChem CID 103845860) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is tert-butyl 2-(2,6-dioxocyclohexyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(2,6-dioxocyclohexyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103845860 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | tert-butyl 2-(2,6-dioxocyclohexyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1C1C(=O)CCCC1=O |
| InChI | InChI=1S/C16H25NO4/c1-16(2,3)21-15(20)17-10-5-4-7-11(17)14-12(18)8-6-9-13(14)19/h11,14H,4-10H2,1-3H3 |
| InChIKey | SPPJJELXXFVETM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|