C8H15NO3 — CID 103846249
methyl N-[(1R,2R)-2-hydroxycyclohexyl]carbamate (PubChem CID 103846249) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is methyl N-[(1R,2R)-2-hydroxycyclohexyl]carbamate.
| Compound Name | methyl N-[(1R,2R)-2-hydroxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 103846249 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | methyl N-[(1R,2R)-2-hydroxycyclohexyl]carbamate |
| SMILES | COC(=O)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C8H15NO3/c1-12-8(11)9-6-4-2-3-5-7(6)10/h6-7,10H,2-5H2,1H3,(H,9,11)/t6-,7-/m1/s1 |
| InChIKey | GHPZAZROCFSCDQ-RNFRBKRXSA-N |
| XLogP | 0.65 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |