C19H24N4O4 — CID 10384651
2-[1-[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]piperidin-2-yl]acetic acid (PubChem CID 10384651) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-[1-[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]piperidin-2-yl]acetic acid.
| Compound Name | 2-[1-[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]piperidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 10384651 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-[1-[2-[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetyl]piperidin-2-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(C2=NOC(CC(=O)N3CCCCC3CC(=O)O)C2)cc1 |
| InChI | InChI=1S/C19H24N4O4/c20-19(21)13-6-4-12(5-7-13)16-10-15(27-22-16)11-17(24)23-8-2-1-3-14(23)9-18(25)26/h4-7,14-15H,1-3,8-11H2,(H3,20,21)(H,25,26) |
| InChIKey | FCGAIJHNBXQCGH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 129.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|