C7H15N3O2 — CID 103847255
1-[(3-hydroxyoxolan-3-yl)methyl]-2-methylguanidine (PubChem CID 103847255) has the molecular formula C7H15N3O2 and a molecular weight of 173.22 g/mol. Its IUPAC name is 1-[(3-hydroxyoxolan-3-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[(3-hydroxyoxolan-3-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 103847255 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 1-[(3-hydroxyoxolan-3-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NCC1(O)CCOC1 |
| InChI | InChI=1S/C7H15N3O2/c1-9-6(8)10-4-7(11)2-3-12-5-7/h11H,2-5H2,1H3,(H3,8,9,10) |
| InChIKey | FWWYKVZGGWQLIK-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|