C11H12F2N2O4 — CID 103847690
3-[(2,6-difluoro-4-nitroanilino)methyl]oxolan-3-ol (PubChem CID 103847690) has the molecular formula C11H12F2N2O4 and a molecular weight of 274.22 g/mol. Its IUPAC name is 3-[(2,6-difluoro-4-nitroanilino)methyl]oxolan-3-ol.
| Compound Name | 3-[(2,6-difluoro-4-nitroanilino)methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 103847690 |
| Molecular Formula | C11H12F2N2O4 |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 3-[(2,6-difluoro-4-nitroanilino)methyl]oxolan-3-ol |
| SMILES | O=[N+]([O-])c1cc(F)c(NCC2(O)CCOC2)c(F)c1 |
| InChI | InChI=1S/C11H12F2N2O4/c12-8-3-7(15(17)18)4-9(13)10(8)14-5-11(16)1-2-19-6-11/h3-4,14,16H,1-2,5-6H2 |
| InChIKey | YSCOUCBIVNYLMJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|