C12H14N4O2 — CID 103847712
3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol (PubChem CID 103847712) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol.
| Compound Name | 3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 103847712 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol |
| SMILES | OC1(CNc2ccc3nccnc3n2)CCOC1 |
| InChI | InChI=1S/C12H14N4O2/c17-12(3-6-18-8-12)7-15-10-2-1-9-11(16-10)14-5-4-13-9/h1-2,4-5,17H,3,6-8H2,(H,14,15,16) |
| InChIKey | CLUYXSZMYXLGMW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |