About 3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol
3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol (PubChem CID 103847712) has the molecular formula C12H14N4O2
and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol.
Molecular Properties
| Compound Name | 3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol |
| PubChem CID | 103847712 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol |
| SMILES | OC1(CNc2ccc3nccnc3n2)CCOC1 |
| InChI | InChI=1S/C12H14N4O2/c17-12(3-6-18-8-12)7-15-10-2-1-9-11(16-10)14-5-4-13-9/h1-2,4-5,17H,3,6-8H2,(H,14,15,16) |
| InChIKey | CLUYXSZMYXLGMW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol?
The IUPAC name of 3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol (CID 103847712) is 3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol.
What is the SMILES notation for 3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol?
The canonical SMILES for 3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol is OC1(CNc2ccc3nccnc3n2)CCOC1.
What is the InChIKey of 3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol?
The InChIKey is CLUYXSZMYXLGMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2/c17-12(3-6-18-8-12)7-15-10-2-1-9-11(16-10)14-5-4-13-9/h1-2,4-5,17H,3,6-8H2,(H,14,15,16).
What are the key properties of 3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol?
3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol has a molecular weight of 246.27 g/mol, XLogP of 0.59, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(pyrido[2,3-b]pyrazin-6-ylamino)methyl]oxolan-3-ol is sourced from PubChem (CID 103847712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).