C12H16FNO4S — CID 103848081
3-fluoro-N-[(3-hydroxyoxolan-3-yl)methyl]-4-methylbenzenesulfonamide (PubChem CID 103848081) has the molecular formula C12H16FNO4S and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-fluoro-N-[(3-hydroxyoxolan-3-yl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | 3-fluoro-N-[(3-hydroxyoxolan-3-yl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 103848081 |
| Molecular Formula | C12H16FNO4S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 3-fluoro-N-[(3-hydroxyoxolan-3-yl)methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC2(O)CCOC2)cc1F |
| InChI | InChI=1S/C12H16FNO4S/c1-9-2-3-10(6-11(9)13)19(16,17)14-7-12(15)4-5-18-8-12/h2-3,6,14-15H,4-5,7-8H2,1H3 |
| InChIKey | GHOQZENAVZMTAC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |