C11H13Cl2NO4S — CID 103848090
2,6-dichloro-N-[(3-hydroxyoxolan-3-yl)methyl]benzenesulfonamide (PubChem CID 103848090) has the molecular formula C11H13Cl2NO4S and a molecular weight of 326.20 g/mol. Its IUPAC name is 2,6-dichloro-N-[(3-hydroxyoxolan-3-yl)methyl]benzenesulfonamide.
| Compound Name | 2,6-dichloro-N-[(3-hydroxyoxolan-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103848090 |
| Molecular Formula | C11H13Cl2NO4S |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 2,6-dichloro-N-[(3-hydroxyoxolan-3-yl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1(O)CCOC1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H13Cl2NO4S/c12-8-2-1-3-9(13)10(8)19(16,17)14-6-11(15)4-5-18-7-11/h1-3,14-15H,4-7H2 |
| InChIKey | LDWYQHAWOWYMCL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |