C8H11F4NO3 — CID 103848818
2,2,3,3-tetrafluoro-N-[(3-hydroxyoxolan-3-yl)methyl]propanamide (PubChem CID 103848818) has the molecular formula C8H11F4NO3 and a molecular weight of 245.17 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[(3-hydroxyoxolan-3-yl)methyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[(3-hydroxyoxolan-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 103848818 |
| Molecular Formula | C8H11F4NO3 |
| Molecular Weight | 245.17 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[(3-hydroxyoxolan-3-yl)methyl]propanamide |
| SMILES | O=C(NCC1(O)CCOC1)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H11F4NO3/c9-5(10)8(11,12)6(14)13-3-7(15)1-2-16-4-7/h5,15H,1-4H2,(H,13,14) |
| InChIKey | GJLJKDLGVMOYKO-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.17 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|