C13H22N2O4 — CID 103849464
N-[3-[(3-hydroxyoxolan-3-yl)methylamino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide (PubChem CID 103849464) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is N-[3-[(3-hydroxyoxolan-3-yl)methylamino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | N-[3-[(3-hydroxyoxolan-3-yl)methylamino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 103849464 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | N-[3-[(3-hydroxyoxolan-3-yl)methylamino]-3-oxopropyl]-2-methylcyclopropane-1-carboxamide |
| SMILES | CC1CC1C(=O)NCCC(=O)NCC1(O)CCOC1 |
| InChI | InChI=1S/C13H22N2O4/c1-9-6-10(9)12(17)14-4-2-11(16)15-7-13(18)3-5-19-8-13/h9-10,18H,2-8H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | SBVXCEWUZWTHQR-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |