C13H17NO4 — CID 103849795
N-[(3-hydroxyoxolan-3-yl)methyl]-2-(2-hydroxyphenyl)acetamide (PubChem CID 103849795) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is N-[(3-hydroxyoxolan-3-yl)methyl]-2-(2-hydroxyphenyl)acetamide.
| Compound Name | N-[(3-hydroxyoxolan-3-yl)methyl]-2-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 103849795 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-[(3-hydroxyoxolan-3-yl)methyl]-2-(2-hydroxyphenyl)acetamide |
| SMILES | O=C(Cc1ccccc1O)NCC1(O)CCOC1 |
| InChI | InChI=1S/C13H17NO4/c15-11-4-2-1-3-10(11)7-12(16)14-8-13(17)5-6-18-9-13/h1-4,15,17H,5-9H2,(H,14,16) |
| InChIKey | WOLODWWUUJSAHJ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |