C20H28O7 — CID 10385112
4-[8-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-5,6,7,8-tetrahydronaphthalen-2-yl]butanoic acid (PubChem CID 10385112) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is 4-[8-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-5,6,7,8-tetrahydronaphthalen-2-yl]butanoic acid.
| Compound Name | 4-[8-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-5,6,7,8-tetrahydronaphthalen-2-yl]butanoic acid |
|---|---|
| PubChem CID | 10385112 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 4-[8-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-5,6,7,8-tetrahydronaphthalen-2-yl]butanoic acid |
| SMILES | C[C@@H]1O[C@@H](OC2CCCc3ccc(CCCC(=O)O)cc32)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H28O7/c1-11-17(23)18(24)19(25)20(26-11)27-15-6-3-5-13-9-8-12(10-14(13)15)4-2-7-16(21)22/h8-11,15,17-20,23-25H,2-7H2,1H3,(H,21,22)/t11-,15?,17+,18+,19-,20-/m0/s1 |
| InChIKey | RXFUNNYFXJBNGN-MRIFFEJISA-N |
| XLogP | 1.32 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |