C18H20N2 — CID 103851300
2-[[1-(2,4-dimethylphenyl)ethylamino]methyl]benzonitrile (PubChem CID 103851300) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-[[1-(2,4-dimethylphenyl)ethylamino]methyl]benzonitrile.
| Compound Name | 2-[[1-(2,4-dimethylphenyl)ethylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 103851300 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 2-[[1-(2,4-dimethylphenyl)ethylamino]methyl]benzonitrile |
| SMILES | Cc1ccc(C(C)NCc2ccccc2C#N)c(C)c1 |
| InChI | InChI=1S/C18H20N2/c1-13-8-9-18(14(2)10-13)15(3)20-12-17-7-5-4-6-16(17)11-19/h4-10,15,20H,12H2,1-3H3 |
| InChIKey | XDAIBDOPPKVORA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |