C10H21N3O — CID 103852808
2-(2-but-3-enoxyethyl)-1-propan-2-ylguanidine (PubChem CID 103852808) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 2-(2-but-3-enoxyethyl)-1-propan-2-ylguanidine.
| Compound Name | 2-(2-but-3-enoxyethyl)-1-propan-2-ylguanidine |
|---|---|
| PubChem CID | 103852808 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 2-(2-but-3-enoxyethyl)-1-propan-2-ylguanidine |
| SMILES | C=CCCOCC/N=C(\N)NC(C)C |
| InChI | InChI=1S/C10H21N3O/c1-4-5-7-14-8-6-12-10(11)13-9(2)3/h4,9H,1,5-8H2,2-3H3,(H3,11,12,13) |
| InChIKey | CETGXLKOIZSQMC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|