About 3-(2-But-3-enoxyethyl)-1,1-dimethylurea
3-(2-But-3-enoxyethyl)-1,1-dimethylurea (PubChem CID 103853136) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is 3-(2-but-3-enoxyethyl)-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-(2-But-3-enoxyethyl)-1,1-dimethylurea |
| PubChem CID | 103853136 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 3-(2-but-3-enoxyethyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCOCCC=C |
| InChI | InChI=1S/C9H18N2O2/c1-4-5-7-13-8-6-10-9(12)11(2)3/h4H,1,5-8H2,2-3H3,(H,10,12) |
| InChIKey | JBRQVSMNRMRCJM-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 41.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | 158 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-But-3-enoxyethyl)-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-But-3-enoxyethyl)-1,1-dimethylurea?
The IUPAC name of 3-(2-But-3-enoxyethyl)-1,1-dimethylurea (CID 103853136) is 3-(2-but-3-enoxyethyl)-1,1-dimethylurea.
What is the SMILES notation for 3-(2-But-3-enoxyethyl)-1,1-dimethylurea?
The canonical SMILES for 3-(2-But-3-enoxyethyl)-1,1-dimethylurea is CN(C)C(=O)NCCOCCC=C.
What is the InChIKey of 3-(2-But-3-enoxyethyl)-1,1-dimethylurea?
The InChIKey is JBRQVSMNRMRCJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-4-5-7-13-8-6-10-9(12)11(2)3/h4H,1,5-8H2,2-3H3,(H,10,12).
What are the key properties of 3-(2-But-3-enoxyethyl)-1,1-dimethylurea?
3-(2-But-3-enoxyethyl)-1,1-dimethylurea has a molecular weight of 186.25 g/mol, XLogP of 0.50, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-But-3-enoxyethyl)-1,1-dimethylurea is sourced from PubChem (CID 103853136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).