C13H12IN3OS — CID 10385374
2-iodo-4-(3,4,4-trimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl)benzonitrile (PubChem CID 10385374) has the molecular formula C13H12IN3OS and a molecular weight of 385.23 g/mol. Its IUPAC name is 2-iodo-4-(3,4,4-trimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl)benzonitrile.
| Compound Name | 2-iodo-4-(3,4,4-trimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 10385374 |
| Molecular Formula | C13H12IN3OS |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | 2-iodo-4-(3,4,4-trimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl)benzonitrile |
| SMILES | CN1C(=S)N(c2ccc(C#N)c(I)c2)C(=O)C1(C)C |
| InChI | InChI=1S/C13H12IN3OS/c1-13(2)11(18)17(12(19)16(13)3)9-5-4-8(7-15)10(14)6-9/h4-6H,1-3H3 |
| InChIKey | CQZKJGPCOQHMKP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|