C16H22BrNO3 — CID 103854412
N-[(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-2-but-3-enoxyethanamine (PubChem CID 103854412) has the molecular formula C16H22BrNO3 and a molecular weight of 356.26 g/mol. Its IUPAC name is N-[(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-2-but-3-enoxyethanamine.
| Compound Name | N-[(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-2-but-3-enoxyethanamine |
|---|---|
| PubChem CID | 103854412 |
| Molecular Formula | C16H22BrNO3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | N-[(6-bromo-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-2-but-3-enoxyethanamine |
| SMILES | C=CCCOCCNCc1cc(Br)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C16H22BrNO3/c1-2-3-6-19-9-5-18-12-13-10-14(17)16-15(11-13)20-7-4-8-21-16/h2,10-11,18H,1,3-9,12H2 |
| InChIKey | NUBXANHLKVDWNO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|