C16H19N3O — CID 103856185
(E)-3-(2,4-dimethylphenyl)-N-[1-(1H-pyrazol-4-yl)ethyl]prop-2-enamide (PubChem CID 103856185) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is (E)-3-(2,4-dimethylphenyl)-N-[1-(1H-pyrazol-4-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethylphenyl)-N-[1-(1H-pyrazol-4-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 103856185 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | (E)-3-(2,4-dimethylphenyl)-N-[1-(1H-pyrazol-4-yl)ethyl]prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)NC(C)c2cn[nH]c2)c(C)c1 |
| InChI | InChI=1S/C16H19N3O/c1-11-4-5-14(12(2)8-11)6-7-16(20)19-13(3)15-9-17-18-10-15/h4-10,13H,1-3H3,(H,17,18)(H,19,20)/b7-6+ |
| InChIKey | XGIZYPRQZARZGE-VOTSOKGWSA-N |
| XLogP | 2.92 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|