C25H40O3 — CID 10385633
(2S,3R,4S,5R,6R)-6-[(2E,4E,8E,10E)-6,8-dimethylpentadeca-2,4,8,10,14-pentaenyl]-2,3,5-trimethyloxane-2,4-diol (PubChem CID 10385633) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-6-[(2E,4E,8E,10E)-6,8-dimethylpentadeca-2,4,8,10,14-pentaenyl]-2,3,5-trimethyloxane-2,4-diol.
| Compound Name | (2S,3R,4S,5R,6R)-6-[(2E,4E,8E,10E)-6,8-dimethylpentadeca-2,4,8,10,14-pentaenyl]-2,3,5-trimethyloxane-2,4-diol |
|---|---|
| PubChem CID | 10385633 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | (2S,3R,4S,5R,6R)-6-[(2E,4E,8E,10E)-6,8-dimethylpentadeca-2,4,8,10,14-pentaenyl]-2,3,5-trimethyloxane-2,4-diol |
| SMILES | C=CCC/C=C/C=C(\C)CC(C)/C=C/C=C/C[C@H]1O[C@](C)(O)[C@H](C)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C25H40O3/c1-7-8-9-10-12-15-19(2)18-20(3)16-13-11-14-17-23-21(4)24(26)22(5)25(6,27)28-23/h7,10-16,20-24,26-27H,1,8-9,17-18H2,2-6H3/b12-10+,14-11+,16-13+,19-15+/t20?,21-,22+,23+,24-,25-/m0/s1 |
| InChIKey | SWUALYMOWVVPCX-YKMKTZHPSA-N |
| XLogP | 5.72 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|