C16H9Cl4NO2 — CID 10385642
4,5,6,7-tetrachloro-2-(2-phenylethyl)isoindole-1,3-dione (PubChem CID 10385642) has the molecular formula C16H9Cl4NO2 and a molecular weight of 389.07 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-(2-phenylethyl)isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-(2-phenylethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 10385642 |
| Molecular Formula | C16H9Cl4NO2 |
| Molecular Weight | 389.07 g/mol |
| Exact Mass | 386.94 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-(2-phenylethyl)isoindole-1,3-dione |
| SMILES | O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C16H9Cl4NO2/c17-11-9-10(12(18)14(20)13(11)19)16(23)21(15(9)22)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | OLHDFCBCGYRAKY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.07 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|