About 6-[4-(4-methoxyphenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid
6-[4-(4-methoxyphenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid (PubChem CID 10385899) has the molecular formula C24H27NO4
and a molecular weight of 393.48 g/mol. Its IUPAC name is 6-[4-(4-methoxyphenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid.
Molecular Properties
| Compound Name | 6-[4-(4-methoxyphenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid |
| PubChem CID | 10385899 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 6-[4-(4-methoxyphenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid |
| SMILES | COc1ccc(-c2cc(OCCCCC(C)(C)C(=O)O)nc3ccccc23)cc1 |
| InChI | InChI=1S/C24H27NO4/c1-24(2,23(26)27)14-6-7-15-29-22-16-20(17-10-12-18(28-3)13-11-17)19-8-4-5-9-21(19)25-22/h4-5,8-13,16H,6-7,14-15H2,1-3H3,(H,26,27) |
| InChIKey | XKGWKDJMXSSHLI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(4-methoxyphenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(4-methoxyphenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid?
The IUPAC name of 6-[4-(4-methoxyphenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid (CID 10385899) is 6-[4-(4-methoxyphenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid.
What is the SMILES notation for 6-[4-(4-methoxyphenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid?
The canonical SMILES for 6-[4-(4-methoxyphenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid is COc1ccc(-c2cc(OCCCCC(C)(C)C(=O)O)nc3ccccc23)cc1.
What is the InChIKey of 6-[4-(4-methoxyphenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid?
The InChIKey is XKGWKDJMXSSHLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27NO4/c1-24(2,23(26)27)14-6-7-15-29-22-16-20(17-10-12-18(28-3)13-11-17)19-8-4-5-9-21(19)25-22/h4-5,8-13,16H,6-7,14-15H2,1-3H3,(H,26,27).
What are the key properties of 6-[4-(4-methoxyphenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid?
6-[4-(4-methoxyphenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid has a molecular weight of 393.48 g/mol, XLogP of 5.57, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(4-methoxyphenyl)quinolin-2-yl]oxy-2,2-dimethylhexanoic acid is sourced from PubChem (CID 10385899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).