C16H20ClN7O3 — CID 10385924
3,5-diamino-6-chloro-N-[N'-[4-(2,4-dihydroxyphenyl)butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 10385924) has the molecular formula C16H20ClN7O3 and a molecular weight of 393.84 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-(2,4-dihydroxyphenyl)butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-(2,4-dihydroxyphenyl)butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 10385924 |
| Molecular Formula | C16H20ClN7O3 |
| Molecular Weight | 393.84 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-(2,4-dihydroxyphenyl)butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | N/C(=N\CCCCc1ccc(O)cc1O)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C16H20ClN7O3/c17-12-14(19)23-13(18)11(22-12)15(27)24-16(20)21-6-2-1-3-8-4-5-9(25)7-10(8)26/h4-5,7,25-26H,1-3,6H2,(H4,18,19,23)(H3,20,21,24,27) |
| InChIKey | PBLGVLWEJGNELV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 185.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.84 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|